![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 4 Kings 2/ | 2024-05-24 16:30 | - | |
| 4 Months, 3 Weeks and 2 Days/ | 2024-02-08 07:51 | - | |
| 5 de chocolate y 1 de fresa/ | 2024-02-20 22:26 | - | |
| 5lbs Of Pressure/ | 2024-03-13 04:56 | - | |
| 7 Plus Seven/ | 2024-02-20 22:26 | - | |
| 9.Starship/ | 2024-07-04 19:15 | - | |
| 10 Lives/ | 2024-06-27 19:53 | - | |
| 10 To Midnight/ | 2024-03-29 14:57 | - | |
| 12 Years A Slave/ | 2024-05-28 04:11 | - | |
| 13 Going on 30/ | 2024-07-21 18:19 | - | |
| 21 Up/ | 2024-02-21 15:27 | - | |
| 49 Up 2005/ | 2024-03-18 20:26 | - | |
| A Cinderella Story Once Upon a Song/ | 2024-02-24 16:05 | - | |
| A Creature Was Stirring/ | 2024-02-20 22:26 | - | |
| A Glimpse Inside The Mind Of Charles Swan IIl/ | 2024-02-20 22:26 | - | |
| A Good Marriage/ | 2024-03-07 21:15 | - | |
| A Grammy Salute To The Beach Boys/ | 2024-02-24 16:05 | - | |
| A Green Fever/ | 2024-03-24 18:24 | - | |
| A Heros Journey The Making of Percy jackson/ | 2024-02-12 18:38 | - | |
| A Killer in the House/ | 2024-08-13 19:52 | - | |
| A Matter of Trus/ | 2024-02-12 17:13 | - | |
| A Part of You/ | 2024-05-31 21:01 | - | |
| A Quiet Place Day One/ | 2024-07-30 16:13 | - | |
| A Sacrifice/ | 2024-07-18 03:50 | - | |
| A Song from the Dark/ | 2024-07-13 19:58 | - | |
| A Soul to Redeem/ | 2024-02-24 16:05 | - | |
| A Walk to Remember/ | 2024-05-18 22:48 | - | |
| Abigail/ | 2024-05-08 16:09 | - | |
| About A Boy/ | 2024-08-01 03:57 | - | |
| Above the Rim/ | 2024-06-17 18:07 | - | |
| Adam Sandler Love You/ | 2024-08-28 04:17 | - | |
| Adam The First/ | 2024-07-18 03:50 | - | |
| After Death/ | 2024-02-27 14:44 | - | |
| Agencia Bien de amores/ | 2024-02-20 22:32 | - | |
| Air Force One Down/ | 2024-03-11 18:23 | - | |
| Alas de Esperanza/ | 2024-02-22 03:48 | - | |
| Alejandra/ | 2024-05-20 01:24 | - | |
| Alice/ | 2024-03-29 17:25 | - | |
| Alicia en el pais de las pesadillas/ | 2024-06-28 16:21 | - | |
| Alien Code/ | 2024-03-18 20:27 | - | |
| Alien Invasion/ | 2024-07-22 05:53 | - | |
| All Of Us Strangers/ | 2024-02-27 19:26 | - | |
| All Roads Lead To Rome/ | 2024-06-13 03:09 | - | |
| All of Us Strangers/ | 2024-02-23 21:23 | - | |
| Almamula/ | 2024-06-25 20:26 | - | |
| Amarte hasta Marte/ | 2024-02-10 18:56 | - | |
| Amelias Children/ | 2024-09-06 01:56 | - | |
| American Dreamer/ | 2024-03-13 04:58 | - | |
| American Fiction/ | 2024-02-08 07:51 | - | |
| American Star/ | 2024-02-08 09:04 | - | |
| American Visa/ | 2024-03-29 17:08 | - | |
| Amityville/ | 2024-04-10 16:42 | - | |
| Amor de madre/ | 2024-02-22 03:49 | - | |
| Amor en Venta/ | 2024-02-22 18:30 | - | |
| Amor en polvo/ | 2024-07-26 15:57 | - | |
| Anastasia/ | 2024-08-08 04:43 | - | |
| Anastasia Once Upon A Time/ | 2024-08-08 04:43 | - | |
| Anatomy 2/ | 2024-04-10 16:42 | - | |
| And Justice for All/ | 2024-06-07 23:44 | - | |
| Andres no quiere dormir la siesta/ | 2024-02-27 14:44 | - | |
| Andy Hardy Meets Debutante/ | 2024-02-29 17:47 | - | |
| Annie Hall/ | 2024-03-29 16:20 | - | |
| Another Cinderella Story/ | 2024-02-20 22:43 | - | |
| Antares de la Luz/ | 2024-04-27 02:24 | - | |
| Anyone But You/ | 2024-03-06 19:26 | - | |
| Apaporis secretos de la selva/ | 2024-04-13 17:36 | - | |
| Apocalypse Now/ | 2024-03-29 15:11 | - | |
| Apollo 13 Survival/ | 2024-09-06 01:56 | - | |
| Arana sagrada/ | 2024-03-26 22:00 | - | |
| Arcadian/ | 2024-05-03 19:26 | - | |
| Argylle/ | 2024-03-06 19:25 | - | |
| Arthur The King/ | 2024-05-05 16:59 | - | |
| Arthur Una amistad sin límites/ | 2024-05-21 14:36 | - | |
| Arthurs Whisky/ | 2024-04-10 16:43 | - | |
| As We Speak/ | 2024-02-29 17:47 | - | |
| Ascenso/ | 2024-02-09 03:29 | - | |
| Asesinato en.el Senado de la Nacion/ | 2024-02-13 20:33 | - | |
| Astro Boy/ | 2024-07-22 05:53 | - | |
| Aterrados/ | 2024-02-21 17:01 | - | |
| Atlantis The Lost Empire/ | 2024-07-03 21:57 | - | |
| Atlas/ | 2024-05-24 17:35 | - | |
| Atraccion peculiar/ | 2024-03-11 18:22 | - | |
| Atrapados en lo profundo/ | 2024-07-04 21:42 | - | |
| A través de tu mirada/ | 2024-02-23 19:31 | - | |
| A traves de tu mirada/ | 2024-02-28 04:22 | - | |
| Au Hasard Balthazar/ | 2024-05-20 01:24 | - | |
| Audi vs. Lancia Carrera por la gloria/ | 2024-05-08 16:09 | - | |
| Author Author/ | 2024-03-29 16:27 | - | |
| Autumn And The Black Jaguar/ | 2024-09-04 03:12 | - | |
| Avanti/ | 2024-03-29 16:42 | - | |
| Babes/ | 2024-07-06 20:29 | - | |
| Baby Assassins/ | 2024-07-30 01:02 | - | |
| Baby Assassins 2 Babies/ | 2024-07-23 15:18 | - | |
| Baby Shark - La Gran Pelicula/ | 2024-05-06 19:33 | - | |
| Bad Behaviour/ | 2024-06-17 02:45 | - | |
| Bad Boys Hasta la muerte/ | 2024-07-22 14:20 | - | |
| Bad Fish/ | 2024-09-12 16:37 | - | |
| Bad Hombres/ | 2024-08-24 04:41 | - | |
| Bade Miyan Chote Miyan/ | 2024-06-25 21:39 | - | |
| Baghead/ | 2024-04-10 16:45 | - | |
| Baki Hanma vs. Kengan Ashura/ | 2024-06-07 23:34 | - | |
| Bandida A Numero Um/ | 2024-09-14 15:38 | - | |
| Bandido/ | 2024-02-20 22:52 | - | |
| Battle Over Britain/ | 2024-07-10 03:27 | - | |
| Battle of the Bulge/ | 2024-02-14 19:08 | - | |
| Beaten to Death/ | 2024-07-19 03:58 | - | |
| Beautiful Kate/ | 2024-05-19 04:02 | - | |
| Beautiful Wedding/ | 2024-06-14 23:32 | - | |
| Becoming King/ | 2024-02-23 21:26 | - | |
| Beetlejuice/ | 2024-09-05 01:32 | - | |
| Before/ | 2024-08-11 16:28 | - | |
| Before Sunrise/ | 2024-08-11 16:28 | - | |
| Before Sunset/ | 2024-08-23 19:05 | - | |
| Before the World Set on Fire/ | 2024-06-13 20:59 | - | |
| Bend It Like Beckham/ | 2024-04-04 22:26 | - | |
| Beverly Hills Cop Axel F/ | 2024-07-03 21:57 | - | |
| Beyond the Visible.Hilma af Klint/ | 2024-03-29 17:24 | - | |
| Bienvenidos al paraiso/ | 2024-09-04 18:22 | - | |
| Big Business/ | 2024-02-12 17:13 | - | |
| Big City Greens the Movie Spacecation/ | 2024-06-13 21:00 | - | |
| Big Fish/ | 2024-07-29 19:26 | - | |
| Billy Budd/ | 2024-03-29 15:04 | - | |
| Bionic/ | 2024-05-31 21:21 | - | |
| Birth/ | 2024-02-21 17:00 | - | |
| BirthRebirth/ | 2024-05-15 17:59 | - | |
| Black Barbie/ | 2024-06-20 04:19 | - | |
| Black Lotus/ | 2024-04-27 02:06 | - | |
| Blaze/ | 2024-07-04 21:40 | - | |
| Bless The chld/ | 2024-02-21 16:59 | - | |
| Blood and Snow/ | 2024-08-01 03:57 | - | |
| Bloodline/ | 2024-03-29 16:44 | - | |
| Bob Marley One Love/ | 2024-03-20 00:26 | - | |
| Boneyard/ | 2024-07-03 22:00 | - | |
| Boomerang/ | 2024-02-12 17:13 | - | |
| Borderlands/ | 2024-08-30 23:13 | - | |
| Borderless Fog/ | 2024-08-08 23:38 | - | |
| Born Innocent/ | 2024-03-11 18:21 | - | |
| Born on the Fourth of July/ | 2024-06-17 17:40 | - | |
| Born to Fight/ | 2024-02-08 08:42 | - | |
| Boxer/ | 2024-09-14 05:50 | - | |
| Boy Kills World/ | 2024-05-31 21:25 | - | |
| Boyfriends And Girlfriends/ | 2024-03-18 20:34 | - | |
| Brasileirinho Grandes Encontros do Choro/ | 2024-02-21 16:58 | - | |
| Bray Wyatt Becoming Immortal/ | 2024-04-04 22:31 | - | |
| Break Up/ | 2024-03-05 19:27 | - | |
| Breaking And Re entering/ | 2024-08-04 16:19 | - | |
| Brief crossing/ | 2024-03-06 19:06 | - | |
| Bring Him Back Dead/ | 2024-05-10 00:03 | - | |
| Bring It On/ | 2024-07-13 19:59 | - | |
| Bring It On All or Nothing/ | 2024-07-13 19:59 | - | |
| Bring It On Fight.to the finish/ | 2024-07-13 19:59 | - | |
| Bring Out the Fear/ | 2024-04-27 02:12 | - | |
| Broadway Danny Rose/ | 2024-03-29 16:27 | - | |
| Broken Lance/ | 2024-08-07 00:33 | - | |
| Brownian Movement/ | 2024-02-20 22:54 | - | |
| Bunker Palace Hotel/ | 2024-04-04 22:02 | - | |
| Burga/ | 2024-06-15 05:39 | - | |
| Butcher s Crossing/ | 2024-08-24 04:42 | - | |
| Bye Bye Tiberias/ | 2024-07-17 18:17 | - | |
| Cómo Encontrar a Alguien Que Sea para Siempre/ | 2024-02-09 02:19 | - | |
| Cómplices del engaño/ | 2024-06-07 23:58 | - | |
| CACERIA HUMANA/ | 2024-07-19 03:57 | - | |
| C H u D/ | 2024-04-01 22:59 | - | |
| CONTINUE/ | 2024-09-07 14:20 | - | |
| COmo Matar a tu Marido/ | 2024-06-02 05:58 | - | |
| Call/ | 2024-02-23 19:34 | - | |
| Calladita/ | 2024-05-18 22:48 | - | |
| Cameras/ | 2024-07-10 03:27 | - | |
| Camp Hideout/ | 2024-02-10 18:59 | - | |
| Canta y no llores/ | 2024-06-26 20:28 | - | |
| Carousel/ | 2024-03-18 20:34 | - | |
| Carried Away/ | 2024-02-27 19:26 | - | |
| Casi estadounidenses/ | 2024-05-16 20:37 | - | |
| Castigos de la traición/ | 2024-05-08 16:29 | - | |
| Casualties of War/ | 2024-06-13 02:10 | - | |
| Cat Ballou/ | 2024-03-18 20:43 | - | |
| Cat and Dog/ | 2024-03-21 15:41 | - | |
| Catching Fire The Story Of Anita Pallenberg/ | 2024-05-13 20:18 | - | |
| Cautiva/ | 2024-02-23 19:45 | - | |
| Ce ancora domani/ | 2024-05-01 17:05 | - | |
| Celeste/ | 2024-04-10 16:47 | - | |
| Cello/ | 2024-06-07 23:48 | - | |
| Ceniza/ | 2024-02-16 02:16 | - | |
| Centurion/ | 2024-02-21 16:57 | - | |
| Cessationist/ | 2024-03-29 15:00 | - | |
| Chained/ | 2024-03-01 19:46 | - | |
| Challengers/ | 2024-05-18 02:47 | - | |
| Chemical Wedding/ | 2024-02-22 20:26 | - | |
| Chi Chi Em Em 2/ | 2024-07-30 04:33 | - | |
| Children of Men/ | 2024-02-27 14:48 | - | |
| Chinas/ | 2024-03-24 18:10 | - | |
| Chocolat/ | 2024-04-13 17:36 | - | |
| Chrome Soldiers/ | 2024-04-13 17:36 | - | |
| Chuck Berry Hail Hail Rock n Roll/ | 2024-02-12 17:13 | - | |
| Circle of Danger/ | 2024-02-14 19:08 | - | |
| City Hunter/ | 2024-04-25 16:35 | - | |
| City of Angels/ | 2024-07-18 16:59 | - | |
| Civil War/ | 2024-06-08 03:46 | - | |
| Claires Knee/ | 2024-02-21 15:30 | - | |
| Clawfoot/ | 2024-09-06 23:38 | - | |
| Close/ | 2024-02-20 22:56 | - | |
| Clouds of Sils Maria/ | 2024-03-18 20:47 | - | |
| Club Zero/ | 2024-08-10 05:20 | - | |
| Coach Carter/ | 2024-06-19 04:38 | - | |
| Code 8 Part 2/ | 2024-02-28 17:42 | - | |
| Coin Locker Girl/ | 2024-08-07 00:32 | - | |
| Colateral/ | 2024-05-08 16:26 | - | |
| Cold Meat/ | 2024-03-29 15:03 | - | |
| Colors of Evil Red/ | 2024-05-31 21:27 | - | |
| Combate clandestino/ | 2024-02-20 22:59 | - | |
| Conception/ | 2024-05-17 04:13 | - | |
| Confesiones/ | 2024-04-25 14:42 | - | |
| Contagion of Fear/ | 2024-08-28 21:49 | - | |
| Control/ | 2024-07-06 20:29 | - | |
| Cora/ | 2024-07-14 19:12 | - | |
| Corre Tiger corre/ | 2024-07-25 03:34 | - | |
| Cosmic Dawn/ | 2024-04-04 21:20 | - | |
| Cousin.cousine/ | 2024-02-13 20:15 | - | |
| Cow.Belles/ | 2024-04-10 16:58 | - | |
| Cracks/ | 2024-06-17 03:25 | - | |
| Creation Of The Gods I Kingdom Of Storms/ | 2024-03-18 20:48 | - | |
| Creeping Death/ | 2024-09-12 16:30 | - | |
| Crescent City/ | 2024-08-18 17:27 | - | |
| Crew/ | 2024-05-26 21:35 | - | |
| Cronaca di una morte annunciata/ | 2024-07-26 15:38 | - | |
| Crossing/ | 2024-09-14 05:51 | - | |
| Crystal Fairy/ | 2024-03-29 17:34 | - | |
| Culpa y deseo/ | 2024-05-23 01:52 | - | |
| Cult Killer/ | 2024-02-20 22:59 | - | |
| Culto al Diablo/ | 2024-03-08 20:24 | - | |
| Curious Caterer Foiled Plans/ | 2024-05-23 02:26 | - | |
| Cyndi Lauper Let the Canary Sing/ | 2024-06-19 03:57 | - | |
| DBZ Los Dos Guerreros Del Futuro Gohan y Trunks/ | 2024-05-18 03:59 | - | |
| DRAGON BALL Z-El plan para erradicar a los Super Saiyans.polo/ | 2024-05-20 02:25 | - | |
| DRAGON BALL Z FUKKATSU NO F FUTURE TRUNKS/ | 2024-05-20 02:17 | - | |
| Daddio/ | 2024-08-04 15:20 | - | |
| Damsel/ | 2024-03-08 20:24 | - | |
| Dandelion/ | 2024-08-18 17:56 | - | |
| Dange/ | 2024-07-10 03:25 | - | |
| Danger on Party Island/ | 2024-03-29 17:55 | - | |
| Dangerous Waters/ | 2024-02-23 19:51 | - | |
| Dashcam/ | 2024-04-13 17:37 | - | |
| Daughters/ | 2024-08-14 19:37 | - | |
| Davy Crockett King of the Wild Frontier/ | 2024-05-20 01:24 | - | |
| Daybreakers/ | 2024-02-20 23:00 | - | |
| De Espaldas al Mundo/ | 2024-08-17 15:59 | - | |
| De Italia con Amor/ | 2024-02-09 00:47 | - | |
| De Vuelta a la Universidad/ | 2024-05-08 17:12 | - | |
| Dead In tombstone/ | 2024-04-01 22:55 | - | |
| Dead Sea/ | 2024-07-30 01:08 | - | |
| Dead Shot/ | 2024-06-19 03:59 | - | |
| Dead Whisper/ | 2024-07-25 23:17 | - | |
| Dead Wrong/ | 2024-06-02 03:34 | - | |
| Death Defying Acts/ | 2024-06-17 03:26 | - | |
| Death Tunnel/ | 2024-05-18 22:48 | - | |
| Death Whisperer/ | 2024-05-26 18:07 | - | |
| Deathtrap/ | 2024-03-18 20:48 | - | |
| Delta Force 2 The Colombian Connection/ | 2024-02-12 17:13 | - | |
| Demasiado mayor para cuentos de hadas 2/ | 2024-06-02 05:58 | - | |
| Den of Thieves/ | 2024-02-16 20:07 | - | |
| Der Samurai/ | 2024-02-12 17:13 | - | |
| Der letzte Zug/ | 2024-03-07 01:07 | - | |
| Der vermessene Mensch/ | 2024-07-14 19:12 | - | |
| Descansar en Paz/ | 2024-03-30 18:04 | - | |
| Descendants/ | 2024-04-09 01:51 | - | |
| Descendientes El ascenso de Red/ | 2024-07-12 17:36 | - | |
| Desde la ultima vez que nos vimos/ | 2024-06-27 19:48 | - | |
| Desiree/ | 2024-02-21 16:44 | - | |
| Desperado/ | 2024-07-22 06:27 | - | |
| DespuEs de la muerteDespués de la muerte/ | 2024-03-26 22:14 | - | |
| Destroy All Neighbors/ | 2024-07-14 19:12 | - | |
| Diana Vreeland The Eye Has to Travel/ | 2024-04-04 21:58 | - | |
| Diario de mi Vagina/ | 2024-03-26 21:48 | - | |
| Didi/ | 2024-09-03 22:44 | - | |
| Die Hart 2 Die Harter/ | 2024-05-31 21:29 | - | |
| Die Tranen meiner Mutter/ | 2024-03-29 15:41 | - | |
| Dirty Work/ | 2024-07-22 19:56 | - | |
| Disco Boy/ | 2024-05-01 17:05 | - | |
| Disco Ibiza Locomia/ | 2024-09-06 17:03 | - | |
| Divertimento/ | 2024-04-13 17:37 | - | |
| Divorcio en negro/ | 2024-07-12 17:36 | - | |
| Django/ | 2024-04-01 22:33 | - | |
| DogMan/ | 2024-02-22 17:25 | - | |
| Domoy/ | 2024-06-15 05:27 | - | |
| Dont Look Away/ | 2024-02-20 23:13 | - | |
| Dont Look at the Demon/ | 2024-06-25 21:33 | - | |
| Dont Turn Out.the Lights/ | 2024-09-07 14:20 | - | |
| Double Blind/ | 2024-03-24 18:08 | - | |
| Dr Giggles/ | 2024-02-20 23:20 | - | |
| Draft Day/ | 2024-02-23 19:53 | - | |
| Dragon Ball Z El ataque del dragón/ | 2024-05-20 02:14 | - | |
| Dragones en el aire/ | 2024-03-24 18:23 | - | |
| Dragonkeeper/ | 2024-07-12 22:27 | - | |
| Drawing Closer/ | 2024-06-27 19:48 | - | |
| Dream 9 Toriko One Piece Dragon Ball Z Super/ | 2024-05-20 02:25 | - | |
| Drifter/ | 2024-03-18 20:49 | - | |
| Drive/ | 2024-09-12 16:30 | - | |
| Drive Away Dolls/ | 2024-03-13 04:57 | - | |
| Drugstore June/ | 2024-03-13 04:58 | - | |
| Duchess/ | 2024-09-09 22:44 | - | |
| Due justice/ | 2024-08-01 03:57 | - | |
| Dune Part Two/ | 2024-04-17 03:23 | - | |
| Earthsea/ | 2024-03-21 15:37 | - | |
| Earworm/ | 2024-02-23 21:27 | - | |
| Echoes of the Thunder/ | 2024-05-10 00:01 | - | |
| Eden Lake/ | 2024-04-10 05:48 | - | |
| Edge of Darkness/ | 2024-03-18 20:50 | - | |
| Eileen/ | 2024-05-08 16:09 | - | |
| Einstein And The Bomb/ | 2024-02-20 23:30 | - | |
| El Amanecer Del Planeta De Los Simios/ | 2024-04-27 04:54 | - | |
| El Amor No Tiene Reglas/ | 2024-02-22 03:51 | - | |
| El Beso del Demonio/ | 2024-06-14 22:52 | - | |
| El Guardián del Hermano/ | 2024-02-09 00:47 | - | |
| El Halcón/ | 2024-06-06 00:46 | - | |
| El Origen Del Planeta De Los Simios/ | 2024-04-27 04:54 | - | |
| El Pasajero/ | 2024-02-09 00:47 | - | |
| El Podcast/ | 2024-05-11 23:17 | - | |
| El Poder de los Centavos/ | 2024-02-09 00:47 | - | |
| El Rostro de la Venganza/ | 2024-08-10 05:21 | - | |
| El Salvador de Almas/ | 2024-05-16 20:41 | - | |
| El Sonido de la Juventud/ | 2024-02-09 03:29 | - | |
| El abuelo y Kid/ | 2024-08-07 16:51 | - | |
| Elaha/ | 2024-09-12 16:30 | - | |
| El arca de Noe/ | 2024-03-24 18:07 | - | |
| El callejon de la muerte/ | 2024-02-28 17:49 | - | |
| El camino de Hill/ | 2024-02-09 00:47 | - | |
| El campeon/ | 2024-07-12 17:36 | - | |
| El control/ | 2024-03-18 20:52 | - | |
| El corazón del cazador/ | 2024-03-29 21:11 | - | |
| El desafío de Marguerite/ | 2024-05-08 16:29 | - | |
| El despertar de los muertos vivientes/ | 2024-02-27 20:58 | - | |
| El guardian de las monarcas/ | 2024-05-13 20:19 | - | |
| Elizabeth Taylor The Lost Tape .2024.720p/ | 2024-08-05 05:03 | - | |
| El juego bonito/ | 2024-03-29 21:10 | - | |
| El juego de la muerte/ | 2024-02-27 15:16 | - | |
| El juego del pulpo/ | 2024-02-29 17:48 | - | |
| El mariachi/ | 2024-07-22 06:28 | - | |
| El nino pez/ | 2024-04-10 16:58 | - | |
| El pajaro Loco se va de campamento/ | 2024-04-12 16:55 | - | |
| El poderoso Zeus/ | 2024-02-29 17:54 | - | |
| El quinteto de la muerte/ | 2024-03-08 20:30 | - | |
| El retorno de los Thundermans/ | 2024-03-08 03:45 | - | |
| El roomie/ | 2024-04-11 18:04 | - | |
| El salario del miedo/ | 2024-03-29 21:02 | - | |
| El santo de la espada/ | 2024-05-20 01:24 | - | |
| El sur/ | 2024-02-12 17:13 | - | |
| El vendedor de ilusiones El caso Generacion Zoe/ | 2024-05-24 17:36 | - | |
| El viaje/ | 2024-04-13 19:21 | - | |
| El viento que arrasa/ | 2024-09-03 22:43 | - | |
| Emboscada/ | 2024-07-22 19:57 | - | |
| Emilio Varela vs Camelia la Texana/ | 2024-07-22 19:57 | - | |
| EmpireQueen The Golden Age Of Magic/ | 2024-09-04 02:04 | - | |
| En La Puntería de Los Asesinos/ | 2024-02-09 01:02 | - | |
| Enamorada/ | 2024-06-12 17:58 | - | |
| En busca del barco perdido/ | 2024-03-08 20:50 | - | |
| En busca de venganza/ | 2024-08-28 21:48 | - | |
| Encontrando el amor en Sisters/ | 2024-06-06 00:40 | - | |
| Endless Borders/ | 2024-05-01 17:17 | - | |
| End of Watch/ | 2024-07-21 18:04 | - | |
| En la Gama de los Grises/ | 2024-04-10 17:03 | - | |
| En nombre de la tierra/ | 2024-05-08 16:25 | - | |
| Enter The Dragon/ | 2024-03-29 16:53 | - | |
| En tierra de santos y pecadores/ | 2024-06-08 00:16 | - | |
| Entre la vie et la mort/ | 2024-07-30 04:37 | - | |
| Entrenado para Matar/ | 2024-03-08 20:54 | - | |
| Epica Retrospect/ | 2024-02-23 20:23 | - | |
| Epica We Will Take You with Us/ | 2024-02-23 20:23 | - | |
| Erase una vez en Euskadi/ | 2024-08-23 20:31 | - | |
| Erik the Viking/ | 2024-02-22 20:26 | - | |
| Errante corazon/ | 2024-03-06 19:06 | - | |
| Escape From Germany/ | 2024-09-04 02:05 | - | |
| Especial Este/ | 2024-08-10 05:23 | - | |
| Es por su bien/ | 2024-06-21 19:25 | - | |
| Estoy bien/ | 2024-06-08 00:08 | - | |
| Eureka/ | 2024-07-17 18:16 | - | |
| Europa/ | 2024-05-19 04:02 | - | |
| Even Hell Has Its Heroes/ | 2024-03-30 17:58 | - | |
| Evidencias de amor/ | 2024-06-02 05:58 | - | |
| Evolution/ | 2024-05-01 17:05 | - | |
| Exhuma/ | 2024-05-15 04:41 | - | |
| Extinction/ | 2024-08-08 06:13 | - | |
| Ezra/ | 2024-06-26 18:37 | - | |
| Fabbricante di lacrime/ | 2024-04-04 21:16 | - | |
| Falling in Love in Niagara/ | 2024-03-29 17:52 | - | |
| Familia nacional/ | 2024-05-18 02:54 | - | |
| Fantasia/ | 2024-07-08 02:08 | - | |
| Fargo/ | 2024-02-09 01:07 | - | |
| Fauna/ | 2024-04-13 17:37 | - | |
| Fear/ | 2024-05-19 21:14 | - | |
| Federer Twelve Final Days/ | 2024-06-21 19:25 | - | |
| Femme Fatale/ | 2024-07-24 19:08 | - | |
| Fentasy/ | 2024-06-13 20:56 | - | |
| Ferrari/ | 2024-04-12 02:05 | - | |
| Ferris Buellers Day Off/ | 2024-02-28 18:16 | - | |
| Fiesta en la madriguera/ | 2024-05-02 18:32 | - | |
| Final Summer/ | 2024-03-18 21:01 | - | |
| Find Me Falling/ | 2024-07-20 22:01 | - | |
| Firebrand/ | 2024-07-06 20:29 | - | |
| Firma aquí/ | 2024-06-21 19:25 | - | |
| First Shift/ | 2024-09-04 21:57 | - | |
| Five Blind Dates/ | 2024-02-13 20:15 | - | |
| Flandres/ | 2024-04-04 22:20 | - | |
| Flight World War II/ | 2024-03-18 21:07 | - | |
| Float/ | 2024-07-14 19:12 | - | |
| Fly Me To The Moon/ | 2024-08-14 14:22 | - | |
| For Love or Money/ | 2024-07-08 02:08 | - | |
| For Sale/ | 2024-06-07 23:46 | - | |
| Four Daughters/ | 2024-07-05 02:34 | - | |
| Four Minutes/ | 2024-04-01 22:31 | - | |
| Fourteen Hours/ | 2024-02-14 19:14 | - | |
| Frances Ha/ | 2024-03-18 21:09 | - | |
| Frankenhooker/ | 2024-03-18 21:14 | - | |
| Franz Klammer - La Leyenda del Esquí/ | 2024-05-15 17:52 | - | |
| Freaknik The Wildest Party Never Told/ | 2024-03-24 18:06 | - | |
| Freedom Hair/ | 2024-09-04 21:56 | - | |
| Fremont/ | 2024-02-08 08:31 | - | |
| French/ | 2024-04-05 17:30 | - | |
| French Girl/ | 2024-05-02 18:32 | - | |
| French Kiss/ | 2024-04-04 21:46 | - | |
| Fresh Kills/ | 2024-07-12 22:27 | - | |
| Freuds Last Session/ | 2024-02-23 21:34 | - | |
| Frida/ | 2024-03-15 05:36 | - | |
| Frogman/ | 2024-03-13 04:58 | - | |
| Fuego contra fuego/ | 2024-04-12 02:05 | - | |
| Full Moon In Paris/ | 2024-03-18 21:15 | - | |
| Fun with Dick and Jane/ | 2024-04-04 21:42 | - | |
| Furia Sin Limites/ | 2024-08-17 15:59 | - | |
| Furiosa A Mad Max Saga/ | 2024-06-25 04:31 | - | |
| Gaga Chromatica Ball/ | 2024-06-20 03:32 | - | |
| Ganymede/ | 2024-09-04 21:56 | - | |
| Garcia y Garcia/ | 2024-07-30 04:16 | - | |
| Garra de hierro/ | 2024-05-11 23:16 | - | |
| Gasoline Rainbow/ | 2024-05-31 21:30 | - | |
| Gassed Up/ | 2024-04-06 01:32 | - | |
| Get Carter/ | 2024-02-20 23:31 | - | |
| Ghost Project/ | 2024-05-23 02:24 | - | |
| Ghostbusters Apocalipsis fantasma/ | 2024-05-08 16:09 | - | |
| Ghostlight.2024.720p.AMZN/ | 2024-08-05 05:03 | - | |
| Giannis The Marvelous Journey/ | 2024-02-24 16:05 | - | |
| Giovanna dArco al rogo/ | 2024-02-12 17:13 | - | |
| Girls On Film/ | 2024-04-06 01:31 | - | |
| Girls State/ | 2024-04-10 17:03 | - | |
| Godless The Eastfield Exorcism/ | 2024-07-10 03:27 | - | |
| Gods of the Deep/ | 2024-02-13 22:39 | - | |
| Godzilla Minus One/ | 2024-06-02 00:57 | - | |
| Godzilla x Kong The New Empire/ | 2024-05-13 20:18 | - | |
| Golden Kamuy/ | 2024-05-19 21:15 | - | |
| Gone Baby Gone/ | 2024-07-22 05:55 | - | |
| Grace of My Heart/ | 2024-03-29 16:45 | - | |
| Grand Jete/ | 2024-04-10 17:04 | - | |
| Great Expectations/ | 2024-06-19 04:04 | - | |
| Groove/ | 2024-08-07 00:33 | - | |
| Gueules Noires/ | 2024-08-20 04:55 | - | |
| Gundam Seed Freedom la película/ | 2024-08-24 05:02 | - | |
| Gunfight at Rio Bravo/ | 2024-05-26 21:35 | - | |
| Gunner/ | 2024-08-18 17:56 | - | |
| Habitación De Escape Sin Salida/ | 2024-02-29 17:59 | - | |
| Hable con ella/ | 2024-04-04 22:10 | - | |
| Hachiko/ | 2024-06-12 17:22 | - | |
| Hack Your Health The Secrets Of Your Gut/ | 2024-05-01 17:05 | - | |
| Hadik/ | 2024-05-26 21:59 | - | |
| Halo Legends/ | 2024-03-18 21:19 | - | |
| Handling The Undead/ | 2024-09-04 03:12 | - | |
| Hard Home/ | 2024-06-30 03:48 | - | |
| Hard Miles/ | 2024-07-06 20:29 | - | |
| Harka/ | 2024-02-08 08:57 | - | |
| Harold and the Purple Crayon/ | 2024-08-28 04:17 | - | |
| He Went That Way/ | 2024-04-30 19:29 | - | |
| Heaven Is For Real/ | 2024-07-30 01:00 | - | |
| Heist 88/ | 2024-07-30 04:16 | - | |
| Hellblazers/ | 2024-04-04 21:05 | - | |
| Herencia siniestra/ | 2024-08-06 06:18 | - | |
| Hickok/ | 2024-04-10 17:04 | - | |
| High Crimes/ | 2024-03-06 19:06 | - | |
| High and Low John Galliano/ | 2024-06-17 17:41 | - | |
| Highlander II The Quickening/ | 2024-02-20 23:34 | - | |
| Hijo del Hombre/ | 2024-03-26 22:19 | - | |
| History of Evil/ | 2024-02-23 21:34 | - | |
| Hook/ | 2024-06-13 02:10 | - | |
| Horizon An American Saga Chapter 1/ | 2024-07-17 18:16 | - | |
| Horror/ | 2024-02-21 15:32 | - | |
| Hostages of war/ | 2024-05-16 20:44 | - | |
| Hot Shots/ | 2024-04-04 22:35 | - | |
| Hotel Desire/ | 2024-06-15 16:00 | - | |
| Hours With Gaspar/ | 2024-04-02 01:49 | - | |
| Housekeeping for Beginners/ | 2024-05-08 16:09 | - | |
| House of Gaa/ | 2024-07-26 15:28 | - | |
| How to Date Billy Walsh/ | 2024-04-05 17:35 | - | |
| How to Eat Fried Worms/ | 2024-06-13 03:19 | - | |
| How to Rob a Bank/ | 2024-06-07 23:31 | - | |
| Humanist Vampire Seeking Consenting Suicidal Person/ | 2024-09-12 16:30 | - | |
| Hunt Club/ | 2024-04-27 02:06 | - | |
| Hush/ | 2024-02-23 20:25 | - | |
| I.S.S/ | 2024-02-08 07:51 | - | |
| I Am Celine Dion/ | 2024-06-26 18:37 | - | |
| I Can/ | 2024-08-18 17:57 | - | |
| IF/ | 2024-06-19 04:05 | - | |
| I Heard the Bells/ | 2024-07-14 19:12 | - | |
| I Saw The TV Glow/ | 2024-06-15 15:41 | - | |
| I Spit on Your Grave/ | 2024-03-01 19:45 | - | |
| I UsedTo Be Funny/ | 2024-06-25 20:25 | - | |
| I Was I Am I Will Be/ | 2024-03-29 15:50 | - | |
| Ice Storm/ | 2024-06-26 20:32 | - | |
| Ignacio of Loyola/ | 2024-06-26 18:37 | - | |
| Il Sol Dell Avvenire/ | 2024-04-10 17:04 | - | |
| Ill Never Forget Whatsisname/ | 2024-02-23 20:26 | - | |
| Imaginary/ | 2024-03-29 21:26 | - | |
| In Fear/ | 2024-03-18 21:26 | - | |
| In Good Hands 2/ | 2024-05-24 17:36 | - | |
| In a Violent Nature/ | 2024-06-30 03:48 | - | |
| Incoming/ | 2024-08-23 20:31 | - | |
| India Song/ | 2024-02-08 07:51 | - | |
| Indiana Jones And The Kingdom Of The Crystal Skull/ | 2024-07-16 14:37 | - | |
| Indiana Jones And The Last Crusade/ | 2024-07-16 14:37 | - | |
| Indiana Jones And The Raiders Of The Lost Ark/ | 2024-07-16 14:37 | - | |
| Indiana Jones And The Temple Of Doom/ | 2024-07-16 14:37 | - | |
| Indiana Jones and the Dial of Destiny/ | 2024-07-16 14:37 | - | |
| Infested/ | 2024-05-02 20:57 | - | |
| Inglourious Basterds/ | 2024-07-03 03:17 | - | |
| Inheritance/ | 2024-06-20 04:15 | - | |
| Inmaculada/ | 2024-07-19 03:57 | - | |
| Insanitarium/ | 2024-05-18 22:48 | - | |
| Inside Out 2/ | 2024-08-20 03:56 | - | |
| Inside The Yellow Cocoon Shell/ | 2024-02-21 15:29 | - | |
| Inside the Mind of a Dog/ | 2024-08-09 20:11 | - | |
| In the heart of the sea/ | 2024-08-07 02:47 | - | |
| Into the Woods/ | 2024-06-17 17:41 | - | |
| Irati/ | 2024-04-13 21:09 | - | |
| Irenas Vow/ | 2024-05-19 07:50 | - | |
| Irish Wish/ | 2024-03-15 18:42 | - | |
| Island Escape/ | 2024-05-23 02:21 | - | |
| Island Of the Dolls/ | 2024-03-24 18:03 | - | |
| JOY/ | 2024-05-27 01:31 | - | |
| Jack/ | 2024-06-17 22:57 | - | |
| Jackpot/ | 2024-08-15 17:48 | - | |
| Jacobs Ladder/ | 2024-07-13 17:09 | - | |
| Jade/ | 2024-04-03 04:33 | - | |
| Jailangkung.Sandekala/ | 2024-08-18 17:55 | - | |
| Jeanne Du Barry/ | 2024-02-09 01:09 | - | |
| Jeff Dunham Arguing With Myself/ | 2024-02-21 16:28 | - | |
| Jeff Dunham Spark Of Insanity/ | 2024-02-21 16:28 | - | |
| Jeff Dunhams Very Special Christmas Special/ | 2024-02-23 20:27 | - | |
| Jeff Who Lives at Home/ | 2024-03-29 17:26 | - | |
| Jeji Telo/ | 2024-05-01 17:05 | - | |
| Jenny Slate Seasoned Professional/ | 2024-02-24 16:05 | - | |
| Jim Henson Idea Man/ | 2024-05-31 21:32 | - | |
| John Wick/ | 2024-07-16 16:21 | - | |
| John Wick 1/ | 2024-07-16 16:22 | - | |
| John Wick 2014/ | 2024-07-16 16:21 | - | |
| John Wick Chapter 4/ | 2024-07-16 16:20 | - | |
| Johnson Family Vacation/ | 2024-06-13 02:11 | - | |
| Joika Una Americana en el Bolshoi/ | 2024-06-06 00:45 | - | |
| Jonah/ | 2024-03-18 21:27 | - | |
| Journey To The West/ | 2024-03-18 21:28 | - | |
| Juanpis González El presidente de la gente/ | 2024-06-28 16:50 | - | |
| Junebug/ | 2024-08-10 05:40 | - | |
| Justice League Crisis on Infinite Earths Part Two/ | 2024-04-24 19:12 | - | |
| Kabut Berduri/ | 2024-08-05 04:16 | - | |
| Kali Ángel vengador/ | 2024-06-02 05:58 | - | |
| Kids Are Growing Up/ | 2024-03-01 19:51 | - | |
| Kill/ | 2024-08-07 00:33 | - | |
| Kill Craft/ | 2024-06-13 20:31 | - | |
| Kinds of Kindness/ | 2024-08-28 04:16 | - | |
| Kingdom of the Planet of the Apes/ | 2024-07-09 01:21 | - | |
| Kleks Academy/ | 2024-06-20 03:32 | - | |
| Klienten/ | 2024-04-27 02:06 | - | |
| Knox Goes Away/ | 2024-04-10 17:07 | - | |
| Kramer Vs Kramer/ | 2024-07-26 15:39 | - | |
| Kubi/ | 2024-06-17 17:40 | - | |
| Kundun/ | 2024-02-13 20:15 | - | |
| Kung Fu Games/ | 2024-09-12 16:30 | - | |
| Kung Fu Jungle/ | 2024-06-17 18:11 | - | |
| Kung Fu Panda/ | 2024-04-09 16:44 | - | |
| La Última Noche en Pacerville/ | 2024-02-09 01:30 | - | |
| La Biblia Jeremias/ | 2024-04-10 05:32 | - | |
| La Chimera/ | 2024-03-18 21:31 | - | |
| La Cima/ | 2024-02-16 02:16 | - | |
| La Contadora de Peliculas/ | 2024-02-20 23:37 | - | |
| La Familia del Barrio La Película/ | 2024-07-03 04:27 | - | |
| La Guerra Del Planeta De Los Simios/ | 2024-04-27 04:54 | - | |
| La Guerra de los Dioses/ | 2024-02-09 01:17 | - | |
| La Lucha de un Guerrero/ | 2024-08-30 23:24 | - | |
| La Luna/ | 2024-02-24 16:05 | - | |
| La Melodía del Amor/ | 2024-02-09 01:23 | - | |
| La Misión/ | 2024-03-26 21:52 | - | |
| La Passion de Dodin Bouffant/ | 2024-03-15 05:36 | - | |
| La Petite/ | 2024-03-29 16:13 | - | |
| La Sirga/ | 2024-03-18 21:40 | - | |
| La Triplemanía XXXII/ | 2024-08-20 04:49 | - | |
| La Vaquilla/ | 2024-03-18 21:41 | - | |
| La bestia humana/ | 2024-03-29 15:41 | - | |
| La bete humaine/ | 2024-03-11 18:21 | - | |
| La cazadora de Auschwitz/ | 2024-03-26 21:45 | - | |
| Lady Scorpions/ | 2024-09-04 02:04 | - | |
| La estrella azul/ | 2024-06-25 20:25 | - | |
| La eterna noche de las doce luna/ | 2024-03-18 21:36 | - | |
| La furia de la montaNA/ | 2024-07-04 18:03 | - | |
| La guerra de los mundos El ataque/ | 2024-07-11 04:50 | - | |
| La habitación del niño/ | 2024-02-08 08:09 | - | |
| La industria del placer/ | 2024-05-02 20:58 | - | |
| La maestra inolvidable/ | 2024-03-18 21:39 | - | |
| La mas grande historia jamas contada/ | 2024-03-29 15:25 | - | |
| La mesita del comedor/ | 2024-05-18 02:54 | - | |
| La montana rusa 2/ | 2024-02-12 17:13 | - | |
| Land Of Bad/ | 2024-02-20 23:37 | - | |
| Land Of Bad SUB/ | 2024-02-27 19:26 | - | |
| Land of Storms/ | 2024-03-18 21:46 | - | |
| Las Aventuras de Lady Marian/ | 2024-03-26 22:10 | - | |
| La secta de la muerte/ | 2024-05-20 01:57 | - | |
| Las hermanas fantástica/ | 2024-08-30 23:12 | - | |
| La sociedad de la nieve Quienes fuimos en la montana/ | 2024-02-12 17:33 | - | |
| La sombra de Caravaggio/ | 2024-04-10 05:28 | - | |
| Las pequeñas cosas/ | 2024-05-09 20:21 | - | |
| Las puertitas del senor Lopez/ | 2024-07-22 19:57 | - | |
| Las que ustedes no quemaron/ | 2024-04-12 02:05 | - | |
| Last Embrace/ | 2024-04-01 22:40 | - | |
| Last Exit to Brooklyn/ | 2024-02-08 07:51 | - | |
| Late Bloomers/ | 2024-06-13 20:31 | - | |
| Late Night With The Devil/ | 2024-05-01 17:05 | - | |
| La terra trema/ | 2024-05-20 01:24 | - | |
| La teta asustada/ | 2024-04-10 17:10 | - | |
| Latido/ | 2024-05-11 23:15 | - | |
| La tour/ | 2024-08-14 19:37 | - | |
| La vida loca/ | 2024-03-29 17:25 | - | |
| Lawman/ | 2024-03-18 21:56 | - | |
| Lawrence of Arabia/ | 2024-03-18 22:00 | - | |
| Le Salaire de la Peur/ | 2024-03-30 17:55 | - | |
| Leave/ | 2024-04-01 22:32 | - | |
| Le consentement/ | 2024-09-14 05:50 | - | |
| Le cri de la soie/ | 2024-03-18 22:05 | - | |
| Legally Blonde The Musical/ | 2024-07-13 17:08 | - | |
| Lenfer/ | 2024-06-17 18:05 | - | |
| Le paradis/ | 2024-02-14 19:15 | - | |
| Les Cyclades/ | 2024-05-18 02:54 | - | |
| Lets Get Harry/ | 2024-07-09 01:50 | - | |
| Life/ | 2024-03-05 19:26 | - | |
| Life After Fighting/ | 2024-06-13 20:30 | - | |
| Liga de la Justicia Crisis en Tierras Infinitas/ | 2024-07-17 18:28 | - | |
| Like Mike/ | 2024-06-13 02:47 | - | |
| Liliom/ | 2024-02-08 08:25 | - | |
| Limitless/ | 2024-02-14 19:16 | - | |
| Lisa Frankenstein/ | 2024-03-29 21:07 | - | |
| Little Birds/ | 2024-05-26 18:07 | - | |
| Little Miss Sunshine/ | 2024-07-04 21:41 | - | |
| Little Richard I Am Everything/ | 2024-07-05 02:34 | - | |
| Little Wing/ | 2024-05-26 21:49 | - | |
| Living with Leopards/ | 2024-05-11 23:16 | - | |
| Llegó a mí/ | 2024-02-16 02:16 | - | |
| Lobola Man/ | 2024-07-12 17:36 | - | |
| Lobos de Arga/ | 2024-06-17 17:42 | - | |
| Longlegs/ | 2024-08-23 20:31 | - | |
| Lo que ignoramos/ | 2024-02-10 07:50 | - | |
| Lord Of Misrule/ | 2024-03-30 18:02 | - | |
| Los 3 reyes magos/ | 2024-02-08 07:51 | - | |
| Los 8 más odiados/ | 2024-07-04 21:42 | - | |
| Los 500 dias de Escobar/ | 2024-07-21 02:34 | - | |
| Los Colegas Del Barrio/ | 2024-09-04 04:11 | - | |
| Los Cuatro Jinetes del Apocalipsis/ | 2024-05-23 02:05 | - | |
| Los colonos/ | 2024-03-29 21:26 | - | |
| Los fierecillos se divierten/ | 2024-03-05 19:27 | - | |
| Los hombres no lloran/ | 2024-07-22 19:58 | - | |
| Los juegos del amor/ | 2024-02-15 02:14 | - | |
| Los justos/ | 2024-07-29 19:45 | - | |
| Los ojos de mi madre/ | 2024-04-10 05:21 | - | |
| Lost Soulz/ | 2024-06-13 20:30 | - | |
| Los verdulero/ | 2024-03-07 21:15 | - | |
| Lotoman/ | 2024-02-14 19:27 | - | |
| Lousy Carter/ | 2024-03-29 17:55 | - | |
| Love Comes Softly/ | 2024-02-12 17:36 | - | |
| Love In Focus/ | 2024-07-28 16:56 | - | |
| Love Letter/ | 2024-05-18 22:48 | - | |
| Love Lies Bleeding/ | 2024-07-20 22:00 | - | |
| Love You Like That/ | 2024-06-15 05:27 | - | |
| Love and Basketball/ | 2024-09-06 17:26 | - | |
| Love and Bruises/ | 2024-04-04 22:09 | - | |
| Lovely Dark And Deep/ | 2024-03-18 22:05 | - | |
| Lovely Dark and Deep/ | 2024-02-23 20:55 | - | |
| Love on the Danube Love Song/ | 2024-09-12 16:30 | - | |
| Lover Stalker Killer/ | 2024-02-14 19:32 | - | |
| Lowlifes/ | 2024-07-18 03:50 | - | |
| Luchar o Morir/ | 2024-03-26 22:12 | - | |
| Lumberjack the Monster/ | 2024-07-03 03:17 | - | |
| Luna sin miel/ | 2024-04-30 19:24 | - | |
| Mátame si te atreves, cariño/ | 2024-02-13 22:39 | - | |
| M La Ultima Esperanza/ | 2024-08-25 16:06 | - | |
| Macbeth/ | 2024-03-29 15:36 | - | |
| Machuca/ | 2024-02-14 19:36 | - | |
| Mad Max/ | 2024-06-28 03:33 | - | |
| Mad Max 2 The Road Warrior/ | 2024-06-28 03:33 | - | |
| Mad Max Beyond Thunderdome/ | 2024-06-28 03:32 | - | |
| Madame Web/ | 2024-03-15 06:24 | - | |
| Made in Abyss Dawn of the Deep Soul/ | 2024-03-11 18:21 | - | |
| Made in England The Films of Powell and Pressburger/ | 2024-06-30 03:48 | - | |
| Mad max fury road/ | 2024-06-28 03:31 | - | |
| Madonna The Girlie Show Live Down Under/ | 2024-06-22 17:10 | - | |
| Madonna The Video Collection/ | 2024-06-22 17:10 | - | |
| Madu/ | 2024-03-30 18:02 | - | |
| Maharaj/ | 2024-07-04 21:43 | - | |
| Malicious/ | 2024-05-09 23:58 | - | |
| Mamacruz/ | 2024-07-22 19:58 | - | |
| Manhattan/ | 2024-03-29 16:10 | - | |
| Manifest West/ | 2024-03-01 19:51 | - | |
| Manodrome/ | 2024-02-09 01:30 | - | |
| Manpower/ | 2024-03-29 17:09 | - | |
| Marca de vida/ | 2024-02-27 15:18 | - | |
| Marcel Prousts Time Regained/ | 2024-02-08 07:51 | - | |
| Maria Candelaria/ | 2024-04-13 17:37 | - | |
| Marley/ | 2024-02-12 17:38 | - | |
| Marshall Mu Gui-Ying/ | 2024-05-26 21:35 | - | |
| Matronas/ | 2024-08-14 00:18 | - | |
| Mavka The Forest Song/ | 2024-02-27 19:26 | - | |
| Mea culpa/ | 2024-02-23 20:29 | - | |
| Mean Girls/ | 2024-02-27 20:58 | - | |
| Measure of Revenge/ | 2024-07-30 04:16 | - | |
| Medidias extremas/ | 2024-04-03 04:33 | - | |
| Meet Me In Rome.2024/ | 2024-02-28 18:17 | - | |
| Megamind vs. The Doom Syndicate/ | 2024-03-01 19:51 | - | |
| Mejor Viuda Que Mal Acompanada/ | 2024-09-06 17:25 | - | |
| Mejores Amigos/ | 2024-03-08 20:56 | - | |
| Memory 2023/ | 2024-02-28 18:17 | - | |
| Men Up/ | 2024-08-01 03:57 | - | |
| Mi Último Deseo/ | 2024-04-12 02:05 | - | |
| Mi Novia Favorita/ | 2024-06-02 05:58 | - | |
| Midnight Peepshow/ | 2024-03-18 22:14 | - | |
| Midnight Stallion/ | 2024-03-18 22:20 | - | |
| Midnight in Paris/ | 2024-03-18 22:13 | - | |
| Mientras Duermes/ | 2024-02-09 01:35 | - | |
| Mike Epps Ready To Sell Out/ | 2024-02-28 18:17 | - | |
| Milagro/ | 2024-02-22 20:26 | - | |
| Milk/ | 2024-02-11 04:26 | - | |
| Miller s Girl/ | 2024-05-02 18:32 | - | |
| Minyan/ | 2024-06-17 03:29 | - | |
| Mission Cross/ | 2024-08-09 20:11 | - | |
| Mistrz/ | 2024-02-08 09:00 | - | |
| Mi villano favorito 4/ | 2024-08-06 06:18 | - | |
| Mobius/ | 2024-03-18 22:24 | - | |
| Moderato cantabile/ | 2024-02-14 19:40 | - | |
| Mommas Boy/ | 2024-08-18 17:56 | - | |
| Mon Laferte Te Amo/ | 2024-08-04 16:20 | - | |
| Mondays See You This Week/ | 2024-05-31 21:01 | - | |
| Monkey Man/ | 2024-07-03 04:23 | - | |
| Monolith/ | 2024-05-20 01:49 | - | |
| Monsieur Hulots Holiday/ | 2024-03-18 22:26 | - | |
| Monster Hunt/ | 2024-07-03 03:17 | - | |
| Monster Island/ | 2024-02-21 16:14 | - | |
| Monster Party/ | 2024-07-13 17:10 | - | |
| Montreal Girls/ | 2024-07-28 16:55 | - | |
| Moon Crash/ | 2024-05-26 21:35 | - | |
| Mori jiuyuan/ | 2024-07-24 06:02 | - | |
| Mother of the Bride/ | 2024-05-09 23:55 | - | |
| Mr Destiny/ | 2024-07-26 15:37 | - | |
| Mr Hollands Opus/ | 2024-08-07 00:32 | - | |
| Mr Right/ | 2024-07-28 16:55 | - | |
| Muchachos la pelicula de la gente/ | 2024-02-13 20:15 | - | |
| Mujeres Rebeldes/ | 2024-03-08 20:59 | - | |
| Mujeres a .borde de un ataque de nervios/ | 2024-04-02 01:42 | - | |
| Multiverso Realidad Paralela/ | 2024-07-04 22:03 | - | |
| Mundo Miraculous París, las aventuras de Shadybug y Claw Noir/ | 2024-04-30 19:28 | - | |
| Munecas de medianoche/ | 2024-02-14 19:44 | - | |
| Murder Company/ | 2024-07-12 22:28 | - | |
| Muri Ko/ | 2024-09-12 16:30 | - | |
| Musica/ | 2024-04-04 21:30 | - | |
| My Blue Heaven/ | 2024-08-23 19:04 | - | |
| My Dreams of You/ | 2024-08-18 18:00 | - | |
| My First Film/ | 2024-09-06 23:38 | - | |
| My Little Pony Equestria Girls/ | 2024-02-28 17:45 | - | |
| My Name Is Loh Kiwan/ | 2024-03-05 19:28 | - | |
| My Neighbors The Yamadas/ | 2024-02-12 17:40 | - | |
| My Oni Girl/ | 2024-05-24 17:37 | - | |
| My Own Private Idaho/ | 2024-07-24 21:52 | - | |
| My Spy/ | 2024-07-18 16:54 | - | |
| My Spy The Eternal City/ | 2024-07-18 16:54 | - | |
| Mysterious Skin/ | 2024-04-02 01:34 | - | |
| Nadie es nadie/ | 2024-05-06 19:26 | - | |
| Nahir/ | 2024-05-23 01:52 | - | |
| Nathalie/ | 2024-02-21 16:12 | - | |
| National Anthem/ | 2024-08-18 17:57 | - | |
| Next Sohee/ | 2024-08-13 19:52 | - | |
| Nice Girls/ | 2024-08-23 19:05 | - | |
| Nieobliczalna/ | 2024-08-04 15:20 | - | |
| Night Of The Missing/ | 2024-02-20 23:38 | - | |
| Night Shift/ | 2024-03-15 05:36 | - | |
| Nightcrawler/ | 2024-03-18 22:27 | - | |
| Nightwatch Ds Are Forever/ | 2024-05-23 01:52 | - | |
| Ninja III The Domination/ | 2024-02-13 20:15 | - | |
| No No A Dockumentary/ | 2024-04-13 17:37 | - | |
| No Time to Spy A Loud HousE Movie/ | 2024-06-22 17:13 | - | |
| No Way Up/ | 2024-04-27 02:06 | - | |
| No abras nunca esa puerta/ | 2024-07-22 20:03 | - | |
| Noche de bodas/ | 2024-06-25 20:43 | - | |
| No es el fin/ | 2024-05-08 16:26 | - | |
| Noise/ | 2024-05-18 22:48 | - | |
| No negociable/ | 2024-07-26 15:57 | - | |
| No puedo vivir sin ti/ | 2024-08-17 15:59 | - | |
| Noryang Deadly Sea/ | 2024-05-23 01:52 | - | |
| Not Another Church Movie/ | 2024-06-02 03:34 | - | |
| Novata espacial/ | 2024-07-04 18:03 | - | |
| Nuestro Hijo/ | 2024-03-26 22:29 | - | |
| Observados/ | 2024-06-28 16:49 | - | |
| Obsessed/ | 2024-05-26 18:07 | - | |
| Odd Thomas/ | 2024-07-03 04:26 | - | |
| Off Ramp/ | 2024-09-07 14:20 | - | |
| Officer Black Belt/ | 2024-09-14 05:51 | - | |
| Off the Map/ | 2024-02-08 08:52 | - | |
| Omerta 612/ | 2024-05-26 22:29 | - | |
| On Fire/ | 2024-03-24 18:00 | - | |
| Once A Thief/ | 2024-02-29 17:55 | - | |
| Once Upon A Time In Mexico/ | 2024-07-22 06:28 | - | |
| One Fast Move/ | 2024-08-08 23:38 | - | |
| One Life/ | 2024-05-10 00:04 | - | |
| One Wild Moment/ | 2024-03-18 22:36 | - | |
| Only God Forgives/ | 2024-07-01 04:18 | - | |
| OperaciOn Esperanza Los niños perdidos en el Amazonas/ | 2024-04-27 02:20 | - | |
| Operation Arctic Cure/ | 2024-02-23 21:05 | - | |
| Operation Petticoat/ | 2024-04-13 17:38 | - | |
| Ordinary Angels/ | 2024-06-11 16:56 | - | |
| Orión y la oscuridad/ | 2024-02-09 01:46 | - | |
| Origin/ | 2024-03-13 04:58 | - | |
| Orlando My Political Biography/ | 2024-04-13 17:49 | - | |
| Ositos Asesinos/ | 2024-06-21 19:25 | - | |
| Ossessione/ | 2024-05-20 01:48 | - | |
| Ostrov/ | 2024-02-08 07:51 | - | |
| Out Come The Wolves/ | 2024-09-04 02:07 | - | |
| Out Of Darkness/ | 2024-04-02 01:49 | - | |
| Out of the Darkness/ | 2024-07-22 20:24 | - | |
| Overboard/ | 2024-05-31 03:31 | - | |
| Ovsyanki/ | 2024-02-21 16:11 | - | |
| Padre en accion/ | 2024-05-16 20:45 | - | |
| PanDmnium/ | 2024-08-28 20:27 | - | |
| Panico en La Montana/ | 2024-02-16 02:16 | - | |
| Papá o mamá/ | 2024-02-20 23:44 | - | |
| Papa o mama/ | 2024-03-06 19:06 | - | |
| Paradox Effect/ | 2024-08-07 00:33 | - | |
| Parallel/ | 2024-03-03 17:03 | - | |
| Pared con pared/ | 2024-04-12 16:57 | - | |
| Parque salvaje/ | 2024-08-24 04:59 | - | |
| Party Monster/ | 2024-07-13 17:09 | - | |
| Pathological The Lies Of Joran Van Der Sloot/ | 2024-02-28 18:18 | - | |
| Pensati sexy/ | 2024-07-14 19:31 | - | |
| Perdidos en la noche/ | 2024-03-29 21:26 | - | |
| Perfect Days/ | 2024-02-20 23:49 | - | |
| Perra vida/ | 2024-05-24 17:37 | - | |
| Perspectiva/ | 2024-07-19 03:57 | - | |
| Petulia/ | 2024-03-29 16:12 | - | |
| Phir Aayi Hasseen Dillruba/ | 2024-08-09 20:11 | - | |
| Picture Of Beauty/ | 2024-06-15 15:59 | - | |
| Piedras en el camino/ | 2024-02-09 01:48 | - | |
| Pileckis Report/ | 2024-06-17 03:32 | - | |
| Plaga zombi Invasión Americana/ | 2024-05-23 01:52 | - | |
| Point Of No Return/ | 2024-06-20 04:44 | - | |
| Polarized/ | 2024-08-10 05:40 | - | |
| Police History/ | 2024-02-08 08:33 | - | |
| Politicamente incorrectos/ | 2024-07-14 19:54 | - | |
| Poolman/ | 2024-06-02 03:34 | - | |
| Poor Cow/ | 2024-02-14 18:35 | - | |
| Poor Things/ | 2024-02-27 15:21 | - | |
| Poppy Field/ | 2024-02-13 20:15 | - | |
| Population Purge/ | 2024-07-13 20:00 | - | |
| Porco Rosso/ | 2024-03-04 19:19 | - | |
| Por tus muertos/ | 2024-07-03 04:26 | - | |
| Posesiones/ | 2024-04-12 16:56 | - | |
| Pretty Guardian Sailor Moon Cosmos/ | 2024-08-24 04:49 | - | |
| Prey/ | 2024-07-30 04:16 | - | |
| Principes salvajes/ | 2024-08-28 21:48 | - | |
| Priscilla/ | 2024-02-27 15:33 | - | |
| Private Property/ | 2024-03-11 18:22 | - | |
| Problemista/ | 2024-07-01 04:18 | - | |
| Project Eerie/ | 2024-02-20 23:50 | - | |
| Project Silence/ | 2024-08-14 00:15 | - | |
| Proyecto Fantasma/ | 2024-03-08 21:10 | - | |
| Puan/ | 2024-04-27 02:21 | - | |
| Puerta de Hierro el exilio de Peron/ | 2024-02-27 19:26 | - | |
| Puppy Love/ | 2024-08-01 03:57 | - | |
| Quad Gods/ | 2024-07-13 20:00 | - | |
| Que Nadie Duerma/ | 2024-02-12 17:42 | - | |
| Queen Rock Montrea/ | 2024-05-15 21:33 | - | |
| Quien Se Quedará con Masha/ | 2024-04-12 02:05 | - | |
| Quien Se Rie Ahora/ | 2024-02-09 01:52 | - | |
| Quien invito a Charlie/ | 2024-02-23 21:10 | - | |
| Quiero que me mantengan/ | 2024-04-04 21:06 | - | |
| Quo Vado/ | 2024-06-17 18:09 | - | |
| RALPH/ | 2024-04-03 04:49 | - | |
| Radio/ | 2024-02-09 02:04 | - | |
| Raging Bull/ | 2024-03-29 15:36 | - | |
| Rambito y Rambon primera mision/ | 2024-02-12 17:45 | - | |
| Rambo/ | 2024-07-16 18:36 | - | |
| Rambo 3/ | 2024-07-16 18:34 | - | |
| Rambo First Blood/ | 2024-07-16 18:35 | - | |
| Rambo First Blood 1/ | 2024-07-16 18:36 | - | |
| Ranma 1 2/ | 2024-02-21 15:58 | - | |
| Rashtra Kavach Om/ | 2024-09-06 17:03 | - | |
| Rebel Moon/ | 2024-04-20 04:52 | - | |
| Rebel Ridge/ | 2024-09-06 23:37 | - | |
| Recursos humanos/ | 2024-02-10 07:51 | - | |
| Red Right Hand/ | 2024-02-23 21:14 | - | |
| Red Rooms/ | 2024-07-29 19:43 | - | |
| Relación Obsesiva/ | 2024-03-08 21:13 | - | |
| Relatos salvajes/ | 2024-03-21 01:58 | - | |
| Remember the Titans/ | 2024-07-18 17:01 | - | |
| Requiem por un sueno/ | 2024-07-04 22:00 | - | |
| Restore Point/ | 2024-02-20 23:56 | - | |
| Resuelto/ | 2024-05-23 02:24 | - | |
| Reunidos El Mundo de Goku/ | 2024-05-20 02:26 | - | |
| Reunion/ | 2024-05-24 16:30 | - | |
| Rewind/ | 2024-06-25 20:25 | - | |
| Ricky Stanicky/ | 2024-03-07 22:58 | - | |
| Ritos ocultos/ | 2024-02-16 02:16 | - | |
| Road House/ | 2024-03-27 01:40 | - | |
| Road Trip Beer Pong/ | 2024-05-01 17:05 | - | |
| Rob Peace/ | 2024-09-12 16:30 | - | |
| Robin And The Hoods/ | 2024-08-10 05:40 | - | |
| Robin Hood Prince of Thieves/ | 2024-08-25 16:06 | - | |
| Robo/ | 2024-04-12 16:57 | - | |
| Robot Dreams/ | 2024-02-10 19:00 | - | |
| Robot dreams/ | 2024-03-30 17:58 | - | |
| Rodeio Rock/ | 2024-04-04 21:10 | - | |
| Rogue Trader/ | 2024-02-14 18:35 | - | |
| Roll Bounce/ | 2024-02-27 14:44 | - | |
| Romeo and Juliet/ | 2024-07-24 19:08 | - | |
| Rosaura a las diez/ | 2024-04-01 22:33 | - | |
| Ru/ | 2024-09-12 16:30 | - | |
| Rubikon/ | 2024-04-10 05:25 | - | |
| Rumba Therapy/ | 2024-02-12 17:45 | - | |
| Ruthless/ | 2024-03-05 19:27 | - | |
| Saben aquell/ | 2024-02-10 19:00 | - | |
| Salome/ | 2024-02-14 18:35 | - | |
| Salomon/ | 2024-04-10 05:32 | - | |
| Salvando al Soldado Perez/ | 2024-07-09 03:32 | - | |
| Sam and Kate/ | 2024-05-06 04:35 | - | |
| Sasquatch Sunset/ | 2024-05-16 02:49 | - | |
| Saving Bikini Bottom The sandy Cheeks Movie/ | 2024-08-03 04:55 | - | |
| Sayen/ | 2024-04-27 02:06 | - | |
| Scoop/ | 2024-04-05 17:37 | - | |
| Scrambled/ | 2024-04-06 01:32 | - | |
| Seagrass/ | 2024-04-06 01:31 | - | |
| Searching/ | 2024-05-26 18:07 | - | |
| Secretos Prohibidos/ | 2024-05-02 20:57 | - | |
| Seducidos por el Deseo/ | 2024-02-09 02:04 | - | |
| See Spot Run/ | 2024-04-04 21:51 | - | |
| Seis es Par/ | 2024-05-02 20:57 | - | |
| Send It/ | 2024-07-30 04:24 | - | |
| Serie Noire/ | 2024-03-29 16:51 | - | |
| Sex And Zen II/ | 2024-02-27 19:26 | - | |
| Sex Positive/ | 2024-08-14 00:22 | - | |
| Shakira Live and Off The.Record/ | 2024-03-18 22:39 | - | |
| Shakira Oral Fixation tour/ | 2024-03-29 15:09 | - | |
| Shakira in Concert El Dorado World Tour/ | 2024-03-29 16:04 | - | |
| Shark The Beginning/ | 2024-02-08 08:24 | - | |
| Sharknado/ | 2024-03-27 04:31 | - | |
| Sharknado 2 The Second One/ | 2024-03-27 02:21 | - | |
| Sharknado 3 Oh Hell No/ | 2024-03-27 02:21 | - | |
| Sharknado 5 Global Swarming/ | 2024-03-27 02:21 | - | |
| Sharknado The 4th.Awakens/ | 2024-03-27 02:21 | - | |
| Sharksploitation/ | 2024-02-14 18:35 | - | |
| Shin Ultraman/ | 2024-06-19 04:13 | - | |
| Shirley/ | 2024-03-24 17:54 | - | |
| Shower/ | 2024-04-02 01:41 | - | |
| Si Fuera Amor/ | 2024-02-09 02:08 | - | |
| Sight/ | 2024-06-25 20:26 | - | |
| Silver Haze/ | 2024-03-30 18:02 | - | |
| Sinister/ | 2024-06-20 04:21 | - | |
| Sinister 2/ | 2024-06-20 04:26 | - | |
| Sira/ | 2024-03-08 21:22 | - | |
| Sismo magnitud 9.5/ | 2024-09-05 01:35 | - | |
| Sister Act/ | 2024-08-25 20:50 | - | |
| Sister Act 2/ | 2024-08-25 20:50 | - | |
| Sister Wife Murder/ | 2024-09-04 02:07 | - | |
| Skincare/ | 2024-09-06 17:25 | - | |
| Skywalkers A Love Story/ | 2024-07-20 22:00 | - | |
| Slapface/ | 2024-02-22 17:21 | - | |
| Sleep El mal no duerme/ | 2024-03-08 21:29 | - | |
| Sleeping Dogs/ | 2024-04-09 17:59 | - | |
| Sleuth/ | 2024-07-26 15:52 | - | |
| Slumdog Millionaire/ | 2024-06-08 04:37 | - | |
| Smoking Tigers/ | 2024-08-28 20:27 | - | |
| Snack Shack/ | 2024-04-02 17:56 | - | |
| Snake in the Eagles Shadow/ | 2024-02-13 20:15 | - | |
| Snoopy Presents Welcome Home Franklin/ | 2024-02-16 07:05 | - | |
| Snow Valley/ | 2024-03-29 17:57 | - | |
| Solo una noche de juegos/ | 2024-07-12 17:36 | - | |
| Sombras siniestras/ | 2024-03-08 21:34 | - | |
| Someone Like You/ | 2024-08-28 20:27 | - | |
| Something in the Water/ | 2024-08-17 15:10 | - | |
| Sometimes I Think About Dying/ | 2024-04-04 22:12 | - | |
| Soudain seuls/ | 2024-07-14 20:01 | - | |
| Sound of Hope The.Story of Possum Trot/ | 2024-08-28 20:27 | - | |
| South Park El Fin de la Obesidad/ | 2024-05-26 22:22 | - | |
| Soylent Green/ | 2024-03-05 19:28 | - | |
| Space Pups/ | 2024-05-31 21:01 | - | |
| Spaceman/ | 2024-03-01 19:46 | - | |
| Sparkle/ | 2024-02-20 23:56 | - | |
| Spellbinder/ | 2024-08-01 03:57 | - | |
| Spermworld/ | 2024-03-30 18:00 | - | |
| Spice World/ | 2024-03-29 15:41 | - | |
| Spotlight/ | 2024-06-22 01:34 | - | |
| Spy x Family Code White/ | 2024-07-31 21:55 | - | |
| Squealer/ | 2024-02-23 21:21 | - | |
| Stagecoach/ | 2024-06-13 03:03 | - | |
| Stake Land/ | 2024-02-08 08:52 | - | |
| StarShip/ | 2024-07-04 19:15 | - | |
| Starship 2004/ | 2024-07-04 19:15 | - | |
| Starship Troopers 3 Marauder/ | 2024-07-04 19:15 | - | |
| Starship Troopers Traitor of Mars/ | 2024-07-04 19:15 | - | |
| Starve Acre/ | 2024-07-28 16:46 | - | |
| Stay Hungry/ | 2024-03-18 22:43 | - | |
| Stiletto/ | 2024-04-13 17:50 | - | |
| Still Crazy/ | 2024-04-10 16:23 | - | |
| Sting/ | 2024-05-16 23:09 | - | |
| Stir Crazy/ | 2024-04-10 16:23 | - | |
| Stomp the Yard/ | 2024-05-18 03:01 | - | |
| Stopmotion/ | 2024-03-18 19:50 | - | |
| Storm Center/ | 2024-05-20 01:24 | - | |
| Stormy/ | 2024-03-21 15:37 | - | |
| Stranded/ | 2024-06-17 03:36 | - | |
| Stranger in the Woods/ | 2024-07-30 17:09 | - | |
| Street Fighter The Legend of Chun Li/ | 2024-02-22 03:32 | - | |
| Stress Positions/ | 2024-05-23 02:22 | - | |
| Strictly Confidential/ | 2024-05-17 04:12 | - | |
| Summer Camp/ | 2024-06-28 01:44 | - | |
| Summer Solstice/ | 2024-08-18 18:05 | - | |
| Sun And Concrete/ | 2024-05-01 17:05 | - | |
| Suncoast/ | 2024-02-10 07:53 | - | |
| Sunset Blvd/ | 2024-03-18 19:50 | - | |
| Sur l Adamant/ | 2024-04-13 17:56 | - | |
| Susana quiere el negro tambien/ | 2024-03-29 15:40 | - | |
| Sustancia Negra/ | 2024-02-09 02:11 | - | |
| Susurros mortales/ | 2024-07-24 15:44 | - | |
| Svaniti nella notte/ | 2024-07-11 21:54 | - | |
| Switch/ | 2024-05-15 16:04 | - | |
| Switchback/ | 2024-02-21 00:00 | - | |
| TE LLEVO EN EL ALMA/ | 2024-05-02 18:32 | - | |
| TERMINATOR 3 LA REBELION DE LAS MAQUINAS/ | 2024-07-16 04:13 | - | |
| THE FIRST SLAM DUNK/ | 2024-02-14 05:54 | - | |
| Take The Money And Run/ | 2024-03-18 19:50 | - | |
| Tantura/ | 2024-02-10 19:01 | - | |
| Tarot/ | 2024-05-31 21:01 | - | |
| Tarot del a muerte/ | 2024-07-24 15:56 | - | |
| Taxidermia/ | 2024-07-05 02:34 | - | |
| Taylor Tomlinson Have It All/ | 2024-02-14 19:46 | - | |
| Tee Yod/ | 2024-07-30 17:07 | - | |
| Teen titans Go To the Movies/ | 2024-04-23 19:45 | - | |
| Temple Grandin/ | 2024-02-08 07:51 | - | |
| Terminator 2 Judgement Day/ | 2024-07-16 04:13 | - | |
| Terminator Dark Fate/ | 2024-07-16 04:13 | - | |
| Terminator Salvation/ | 2024-07-16 18:07 | - | |
| Terminator genisys/ | 2024-07-16 04:13 | - | |
| Terror en Silent Hill/ | 2024-07-04 21:52 | - | |
| Tetsuo II The Body Hammer/ | 2024-04-01 22:35 | - | |
| Tetsuo The Bullet Man/ | 2024-04-01 23:03 | - | |
| Texas Twister/ | 2024-07-12 21:42 | - | |
| That Thing You Do/ | 2024-09-03 22:44 | - | |
| The.Sandlot/ | 2024-07-09 03:29 | - | |
| The.Sandlot 2/ | 2024-07-09 03:29 | - | |
| The Abyss/ | 2024-03-03 21:05 | - | |
| The Adventures of Ford Fairlane/ | 2024-02-24 16:05 | - | |
| The Alamo/ | 2024-04-04 22:22 | - | |
| The American/ | 2024-06-17 17:42 | - | |
| The American Friend/ | 2024-04-10 16:23 | - | |
| The American Society of Magical Negroes/ | 2024-04-03 04:33 | - | |
| The Animal Kingdom/ | 2024-02-21 15:30 | - | |
| The Antisocial Network Memes.to Mayhem/ | 2024-04-05 17:32 | - | |
| The Aviators Wife/ | 2024-03-05 19:26 | - | |
| The Bakery Girl of Monceau/ | 2024-02-22 03:52 | - | |
| The Beach Boys/ | 2024-05-24 17:37 | - | |
| The Beast In The Jungle/ | 2024-06-17 02:45 | - | |
| The Beast Within/ | 2024-08-17 15:10 | - | |
| The Beast of War/ | 2024-06-28 03:32 | - | |
| The Beatles Let It Be/ | 2024-05-18 02:55 | - | |
| The Beautiful Person/ | 2024-03-07 21:14 | - | |
| The Beekeeper/ | 2024-03-01 21:12 | - | |
| The Big Lebowski/ | 2024-08-01 03:57 | - | |
| The Bikeriders/ | 2024-07-10 03:25 | - | |
| The Blob/ | 2024-08-23 19:04 | - | |
| The Bloody Hundredth/ | 2024-03-18 19:50 | - | |
| The Blue Angel/ | 2024-03-21 15:38 | - | |
| The Blue Angels/ | 2024-05-24 16:30 | - | |
| The Book Of Clarence/ | 2024-02-27 14:44 | - | |
| The Boy and the Heron/ | 2024-06-25 20:24 | - | |
| The Boy in the Woods/ | 2024-07-28 16:46 | - | |
| The Breaking Ice/ | 2024-03-30 17:58 | - | |
| The Bricklayer/ | 2024-04-05 17:41 | - | |
| The Bridge Curse Ritual/ | 2024-02-24 16:05 | - | |
| The Canyons/ | 2024-03-29 16:41 | - | |
| The Caregiver/ | 2024-07-25 23:16 | - | |
| The Casagrandes Movie/ | 2024-03-24 17:36 | - | |
| The Chosen One/ | 2024-02-08 08:23 | - | |
| The Cigarette/ | 2024-07-13 20:01 | - | |
| The Cloverfield Paradox/ | 2024-02-08 09:09 | - | |
| The Commandants Shadow/ | 2024-07-25 23:16 | - | |
| The Company Of Wolves/ | 2024-02-14 18:49 | - | |
| The Conversation/ | 2024-04-04 21:38 | - | |
| The Convert/ | 2024-07-12 22:27 | - | |
| The Core/ | 2024-02-08 08:30 | - | |
| The Counselor/ | 2024-06-17 05:31 | - | |
| The Crazies/ | 2024-02-12 17:53 | - | |
| The Crimson Kimono/ | 2024-05-20 01:50 | - | |
| The Crow/ | 2024-09-14 05:51 | - | |
| The Dark Knight Rises/ | 2024-07-17 17:01 | - | |
| The Day After/ | 2024-05-20 01:24 | - | |
| The Dead Dont Hurt/ | 2024-07-18 03:50 | - | |
| The Dead Pool/ | 2024-02-12 17:59 | - | |
| The Deliverance/ | 2024-08-30 23:13 | - | |
| The Demon Disorde/ | 2024-09-06 23:38 | - | |
| The Devils Bath/ | 2024-06-30 03:48 | - | |
| The Donor Party/ | 2024-05-03 18:32 | - | |
| The Duel/ | 2024-08-18 17:56 | - | |
| The End We Start From/ | 2024-02-21 15:40 | - | |
| The Exorcism/ | 2024-07-10 03:26 | - | |
| The Fall Guy/ | 2024-05-21 14:36 | - | |
| The First Omen/ | 2024-08-09 04:18 | - | |
| The Flowers of War/ | 2024-08-06 06:08 | - | |
| The Fly/ | 2024-07-01 04:18 | - | |
| The Flying Deuces/ | 2024-02-21 15:27 | - | |
| The Fog/ | 2024-06-17 17:42 | - | |
| The Forbidden Play/ | 2024-08-07 00:33 | - | |
| The Gang That Couldnt Shoot Straight/ | 2024-03-18 19:50 | - | |
| The Garfield Movie/ | 2024-07-09 01:50 | - | |
| The Ghost And Mrs Muir/ | 2024-03-18 19:50 | - | |
| The Ghost Writer/ | 2024-07-30 04:28 | - | |
| The Girl Who Leapt Through Time/ | 2024-06-13 02:58 | - | |
| The Girl on a Motorcycle/ | 2024-05-20 01:54 | - | |
| The Good Half/ | 2024-09-04 21:57 | - | |
| The Great Escaper/ | 2024-06-17 18:07 | - | |
| The Great Lillian Hall/ | 2024-06-13 20:30 | - | |
| The Greatest Hits/ | 2024-04-12 16:56 | - | |
| The Greatest Love Story Never Told/ | 2024-02-27 15:44 | - | |
| The Green Ray/ | 2024-02-21 15:25 | - | |
| The Guardian/ | 2024-03-27 02:21 | - | |
| The Guernsey Literary and Potato Peel Pie Society/ | 2024-02-12 18:01 | - | |
| The Hangman/ | 2024-06-13 20:30 | - | |
| The Heiress And The Handyman/ | 2024-09-04 02:08 | - | |
| The Hi-Lo Country/ | 2024-02-08 08:23 | - | |
| The Hidden/ | 2024-06-17 02:45 | - | |
| The Hoarder/ | 2024-03-03 17:03 | - | |
| The Holy Mountain/ | 2024-07-13 17:09 | - | |
| The House Bunny/ | 2024-03-29 17:13 | - | |
| The Idea of You/ | 2024-05-02 18:44 | - | |
| The Inheritance/ | 2024-07-13 20:00 | - | |
| The Instigators/ | 2024-08-09 20:11 | - | |
| The Interpreter/ | 2024-08-23 20:31 | - | |
| The Inventor/ | 2024-02-22 17:18 | - | |
| The Iron Claw/ | 2024-03-29 17:46 | - | |
| The Iron Giant/ | 2024-07-30 01:05 | - | |
| The Island/ | 2024-05-15 17:38 | - | |
| The Italian Job/ | 2024-06-17 02:45 | - | |
| The Jane Mysteries A Deadly Prescription/ | 2024-09-12 16:30 | - | |
| The January Man/ | 2024-04-10 16:23 | - | |
| The Jester/ | 2024-02-21 04:43 | - | |
| The Judge and the Assassin/ | 2024-03-18 19:50 | - | |
| The Key to Rebecca/ | 2024-02-20 22:25 | - | |
| The Killer/ | 2024-09-03 22:43 | - | |
| The King Tide/ | 2024-08-10 05:23 | - | |
| The Ladies Man/ | 2024-04-04 22:00 | - | |
| The Land of Hope/ | 2024-04-01 22:39 | - | |
| The Last Boy on Earth/ | 2024-08-08 00:15 | - | |
| The Last Rifleman/ | 2024-05-02 18:41 | - | |
| The Last Sharknado Its About Time/ | 2024-03-27 02:21 | - | |
| The Last Wave/ | 2024-02-21 15:24 | - | |
| The Last Winter/ | 2024-03-18 19:50 | - | |
| The Last Witness/ | 2024-09-06 23:38 | - | |
| The Legend of Catclaws Mountain/ | 2024-06-02 03:34 | - | |
| The Lighthorsemen/ | 2024-03-29 14:56 | - | |
| The Lionheart/ | 2024-03-15 05:36 | - | |
| The Listener/ | 2024-05-31 21:01 | - | |
| The Little Mermaid/ | 2024-07-11 21:55 | - | |
| The Long Game/ | 2024-05-02 20:57 | - | |
| The Man From The Diners Club/ | 2024-05-20 01:48 | - | |
| The Man Who Loved Women/ | 2024-03-18 19:50 | - | |
| The Marksman/ | 2024-06-30 03:35 | - | |
| The Ministry of Ungentlemanly Warfare/ | 2024-07-25 14:32 | - | |
| The Moon Spinners/ | 2024-07-29 19:26 | - | |
| The Most Dangerous Game/ | 2024-02-12 18:10 | - | |
| The Mouse Trap/ | 2024-08-07 00:46 | - | |
| The New Boy/ | 2024-07-17 18:16 | - | |
| The Other Side of Midnigh/ | 2024-03-04 19:19 | - | |
| The Parades/ | 2024-06-20 03:31 | - | |
| The Perfect Escape/ | 2024-04-06 01:32 | - | |
| The Picture of Dorian Gray/ | 2024-05-16 20:43 | - | |
| The Pig the Snake and the Pigeon/ | 2024-03-05 19:30 | - | |
| The Pillow Book/ | 2024-02-12 18:14 | - | |
| The Pink Panther Strikes Again/ | 2024-04-13 17:57 | - | |
| The Piper/ | 2024-02-21 15:24 | - | |
| The Primevals/ | 2024-06-13 20:29 | - | |
| The Professor/ | 2024-08-18 04:59 | - | |
| The Puppetman/ | 2024-02-20 22:26 | - | |
| The Quantum Devil/ | 2024-04-27 02:23 | - | |
| The Real Bros of Simi Valley The Movie/ | 2024-07-06 20:29 | - | |
| The Reef/ | 2024-06-13 02:10 | - | |
| The Revenant/ | 2024-02-08 07:51 | - | |
| The Reverend and Mrs Simpson/ | 2024-06-15 05:27 | - | |
| The Rooster/ | 2024-09-04 21:56 | - | |
| The Sadness/ | 2024-08-14 03:39 | - | |
| The Score/ | 2024-05-19 04:01 | - | |
| The Scorpion King/ | 2024-02-08 05:06 | - | |
| The Scorpion King 3 Battle for Redemption/ | 2024-02-08 05:03 | - | |
| The Scorpion King Book of Souls/ | 2024-02-08 05:03 | - | |
| The Scorpion King Rise of a Warrior The Scorpion King 2/ | 2024-02-08 05:03 | - | |
| The Scorpion King The Lost Throne/ | 2024-02-08 05:03 | - | |
| The Sea Wolf/ | 2024-03-18 19:50 | - | |
| The Seeding/ | 2024-02-08 09:04 | - | |
| The Sessions/ | 2024-02-14 19:03 | - | |
| The Seventh Sign/ | 2024-04-01 22:32 | - | |
| The Shift/ | 2024-03-04 19:19 | - | |
| The Shift El gran cambio/ | 2024-05-23 02:20 | - | |
| The Silent Forest/ | 2024-08-25 16:07 | - | |
| The Sixth Sense/ | 2024-07-03 04:24 | - | |
| The Skulls/ | 2024-04-13 17:59 | - | |
| The Space Race/ | 2024-02-14 19:50 | - | |
| The Star Wars Holiday Special/ | 2024-06-17 02:45 | - | |
| The Statement/ | 2024-02-23 20:43 | - | |
| The Stepford Wives/ | 2024-02-27 14:44 | - | |
| The Strangers Chapter 1/ | 2024-07-17 20:06 | - | |
| The Successor/ | 2024-07-29 19:44 | - | |
| The Sunset Limited/ | 2024-08-25 16:07 | - | |
| The Syndrome/ | 2024-09-14 06:27 | - | |
| The Tale of the Princess Kaguya/ | 2024-07-24 19:16 | - | |
| The Tall Men/ | 2024-05-20 01:24 | - | |
| The Teachers Lounge/ | 2024-02-27 14:44 | - | |
| The Teachers LoungeThe Teachers Lounge/ | 2024-08-23 19:04 | - | |
| The Terminator/ | 2024-07-16 04:13 | - | |
| The Texas Chainsa Massacre 2/ | 2024-07-11 04:50 | - | |
| The Texas Chainsaw Massacre/ | 2024-07-08 02:09 | - | |
| The Thin Red Line/ | 2024-07-10 03:24 | - | |
| The Three Caballeros/ | 2024-03-18 20:17 | - | |
| The Three Musketeers/ | 2024-03-03 17:04 | - | |
| The Three Musketeers Milady/ | 2024-04-24 19:12 | - | |
| The Tigers Apprentice/ | 2024-02-12 18:21 | - | |
| The Treasure of the Sierra Madre/ | 2024-07-13 17:08 | - | |
| The Truth Vs Alex Jones/ | 2024-03-29 14:59 | - | |
| The Union/ | 2024-08-17 15:10 | - | |
| The Verdict/ | 2024-06-19 05:17 | - | |
| The Virgin Suicides/ | 2024-06-15 15:59 | - | |
| The Water Horse Legend of the Deep/ | 2024-04-10 16:23 | - | |
| The Way of the Dragon/ | 2024-03-04 19:19 | - | |
| TheWicher/ | 2024-03-03 19:16 | - | |
| The Wicker.Man/ | 2024-03-03 19:05 | - | |
| The Wicker Man/ | 2024-03-03 19:05 | - | |
| The Wilby Conspiracy/ | 2024-03-11 18:23 | - | |
| The Wild/ | 2024-02-20 22:26 | - | |
| The Winter War/ | 2024-04-13 18:02 | - | |
| The Woods Are Real/ | 2024-03-13 05:00 | - | |
| The Zone of Interest/ | 2024-02-21 15:04 | - | |
| The dry 2 La Fuerza de la Naturaleza/ | 2024-05-15 17:52 | - | |
| The greatest/ | 2024-02-14 18:52 | - | |
| The imaginary/ | 2024-07-05 18:49 | - | |
| Thelma The Unicorn/ | 2024-05-18 02:47 | - | |
| Theres Something About Mary/ | 2024-04-02 01:35 | - | |
| The unbreakable Tatiana Suarez/ | 2024-02-12 18:26 | - | |
| They Called Him Mostly Harmless/ | 2024-06-13 02:51 | - | |
| They Shot The Piano Player/ | 2024-03-15 05:36 | - | |
| This Is Me Now/ | 2024-02-16 07:05 | - | |
| Thor God of Thunder/ | 2024-06-26 20:32 | - | |
| Three Amigos/ | 2024-03-18 20:18 | - | |
| Three Blind Mice/ | 2024-02-20 22:26 | - | |
| Three Kings/ | 2024-07-11 05:00 | - | |
| Three Summers/ | 2024-04-01 23:03 | - | |
| Three Thousand Years of Longing/ | 2024-03-24 17:36 | - | |
| Throne Of.Blood/ | 2024-05-20 01:24 | - | |
| TikTok Star Murders/ | 2024-06-30 03:48 | - | |
| Timeless Heroes Indiana Jones And Harrison Ford/ | 2024-07-16 15:32 | - | |
| Todas menos tu/ | 2024-05-05 16:59 | - | |
| Todo el silencio/ | 2024-06-15 05:37 | - | |
| Tokunbo/ | 2024-08-24 04:50 | - | |
| Tony Rome/ | 2024-04-10 16:23 | - | |
| Too Late for Tears/ | 2024-05-20 01:52 | - | |
| Top Dog/ | 2024-02-12 18:27 | - | |
| Tout le plaisir est pour moi/ | 2024-03-06 19:06 | - | |
| Townhouse Confidential/ | 2024-07-28 16:55 | - | |
| Tráfico Sexual/ | 2024-02-16 02:16 | - | |
| Traded/ | 2024-04-10 16:23 | - | |
| Training Day/ | 2024-07-05 02:33 | - | |
| Treasure/ | 2024-08-01 20:14 | - | |
| Trespass/ | 2024-02-23 19:25 | - | |
| Trick r Treat/ | 2024-07-08 02:09 | - | |
| Trigger Warning/ | 2024-06-21 19:25 | - | |
| Tuesday/ | 2024-07-28 16:45 | - | |
| Turbulence/ | 2024-05-19 04:02 | - | |
| Turtles All the Way Down/ | 2024-05-02 18:32 | - | |
| Tusk/ | 2024-02-08 08:50 | - | |
| Twelve Monkeys/ | 2024-03-29 16:42 | - | |
| Twilight Portrait/ | 2024-03-29 17:38 | - | |
| Twister/ | 2024-07-12 21:42 | - | |
| Twisters/ | 2024-08-11 17:45 | - | |
| Tykho Moon/ | 2024-04-10 16:23 | - | |
| UFC.303.PPV.Pereira.vs.Prochazka/ | 2024-06-30 18:45 | - | |
| UFC.on.ABC.7.Sandhagen.vs.Nurmagomedov..WEB-DL.H264.Fight-BB[TGx]/ | 2024-08-05 05:03 | - | |
| UFC.on.ABC.7.Sandhagen.vs.Nurmagomedov.Prelims.WEB-DL.H264.Fight-BB[TGx]/ | 2024-08-05 05:02 | - | |
| UFC.on.ESPN.59.Namajunas.vs.Cortez.Prelims/ | 2024-07-14 20:02 | - | |
| UFC.on.ESPN.59.Namajunas.vs.Cortez/ | 2024-07-14 20:03 | - | |
| UFC 302 Early Prelims/ | 2024-06-02 03:34 | - | |
| UFC 303 Early Prelims WEBDL.H264.Fight-BB/ | 2024-06-30 03:41 | - | |
| UFC 304 PPV Edwards Vs Muhammad/ | 2024-07-28 16:45 | - | |
| UFC 305 Du Plessis Vs Adesanya/ | 2024-08-18 17:54 | - | |
| UFC on ESPN 60 Lemos vs Jandiroba/ | 2024-07-21 16:24 | - | |
| UFC on ESPN 60 Lemos vs Jandiroba Prelims/ | 2024-07-21 16:31 | - | |
| Uglies/ | 2024-09-14 05:52 | - | |
| Ultimas Voluntades/ | 2024-02-12 18:30 | - | |
| Ultraman Rising/ | 2024-06-15 05:37 | - | |
| Un Hipster en la Espana Vacia/ | 2024-03-27 04:35 | - | |
| Un Hombre Sin Memoria/ | 2024-02-22 04:00 | - | |
| Una Mujer Contra un País/ | 2024-03-08 20:24 | - | |
| Una Noche en el Infierno/ | 2024-02-22 04:10 | - | |
| Un actor malo/ | 2024-07-01 04:20 | - | |
| Una jauria llamada Ernesto/ | 2024-06-26 18:37 | - | |
| Un amor/ | 2024-04-10 16:39 | - | |
| Un asesinato sin duda/ | 2024-03-15 18:38 | - | |
| Un asunto familiar/ | 2024-06-28 16:50 | - | |
| Under Paris/ | 2024-06-07 23:36 | - | |
| Under The Boardwalk/ | 2024-03-11 18:22 | - | |
| Under The Hawthorn Tree/ | 2024-02-14 19:04 | - | |
| Undercover Brother/ | 2024-02-12 18:33 | - | |
| Unfrosted/ | 2024-05-03 18:33 | - | |
| Unicorn Wars La pelicula/ | 2024-03-26 21:45 | - | |
| Un ladron romantico/ | 2024-03-14 23:40 | - | |
| Unsung Hero/ | 2024-07-17 18:17 | - | |
| Untold Hope Solo vs U S Soccer/ | 2024-09-06 01:56 | - | |
| Untold The Murder of Air McNair/ | 2024-08-23 19:18 | - | |
| Un viaje hacia la noche/ | 2024-02-28 04:22 | - | |
| Up in the Air/ | 2024-03-05 01:07 | - | |
| Uproar/ | 2024-03-29 17:54 | - | |
| Uptown Girls/ | 2024-06-13 03:20 | - | |
| Us Our Pets And The War/ | 2024-09-04 02:21 | - | |
| Uzak/ | 2024-02-12 18:36 | - | |
| Vacaciones intercambiadas/ | 2024-07-26 15:54 | - | |
| Vampiras Resurrección/ | 2024-06-14 22:52 | - | |
| Vazante/ | 2024-03-06 19:06 | - | |
| Vertige/ | 2024-02-22 03:48 | - | |
| Victory Through Air Power/ | 2024-02-08 08:37 | - | |
| Videodrome/ | 2024-08-15 17:48 | - | |
| Viento negro/ | 2024-02-14 19:07 | - | |
| Vile/ | 2024-03-18 20:19 | - | |
| Vinyan/ | 2024-03-18 20:19 | - | |
| Visher/ | 2024-07-28 16:57 | - | |
| Visitante de invierno/ | 2024-04-04 22:18 | - | |
| Viviendo mi pelicula/ | 2024-02-14 19:46 | - | |
| Volkov - El nombre de la Violencia/ | 2024-06-14 22:53 | - | |
| WHERE HOPE GROWS/ | 2024-07-07 02:46 | - | |
| WWE.SMACKDOWN.2024.07.12.HDTV/ | 2024-07-14 20:03 | - | |
| WWE Backlash France/ | 2024-05-06 19:32 | - | |
| WWE Elimination Chamber/ | 2024-02-27 14:44 | - | |
| WWE King and Queen of the Ring/ | 2024-05-26 22:19 | - | |
| WWE Royal Rumble/ | 2024-02-08 06:04 | - | |
| WWE SMACKDOWN 2024 07 19/ | 2024-07-21 16:32 | - | |
| WWE WrestleMania XL Saturday/ | 2024-04-10 16:41 | - | |
| Waiting for Bojangles/ | 2024-07-05 18:49 | - | |
| Wallbanger/ | 2024-08-28 20:27 | - | |
| Wanted Man Se busca/ | 2024-05-11 23:19 | - | |
| War Is Over/ | 2024-03-15 05:36 | - | |
| War and Peace Part I/ | 2024-02-27 14:44 | - | |
| Watchmen Chapter I/ | 2024-08-14 19:37 | - | |
| Waves/ | 2024-03-03 19:05 | - | |
| We Are Zombies/ | 2024-08-14 19:38 | - | |
| We Grown Now/ | 2024-06-20 04:20 | - | |
| We Were Soldier/ | 2024-06-13 02:10 | - | |
| Weak Layers/ | 2024-03-13 04:57 | - | |
| What Comes Around/ | 2024-05-31 21:01 | - | |
| What You Wish For/ | 2024-06-02 03:34 | - | |
| When Animals Dream/ | 2024-03-05 19:30 | - | |
| When Love Is Not Enough The Lois Wilson Story/ | 2024-04-01 22:33 | - | |
| Which Brings Me to You/ | 2024-05-02 18:50 | - | |
| White Dog/ | 2024-03-18 20:22 | - | |
| Whitewash/ | 2024-03-29 17:20 | - | |
| Wicker Park/ | 2024-05-18 22:48 | - | |
| Widow Clicquot/ | 2024-08-09 20:11 | - | |
| Wild Eyed and Wicked/ | 2024-06-13 20:29 | - | |
| Wild Wild Punjab/ | 2024-07-11 05:02 | - | |
| Wildcat/ | 2024-07-13 19:58 | - | |
| Willard/ | 2024-06-20 04:08 | - | |
| Windcatcher/ | 2024-03-29 17:52 | - | |
| Winnie The Pooh Miel y sangre 2/ | 2024-07-04 18:03 | - | |
| Winnie the Pooh Blood and Honey 2/ | 2024-06-13 20:29 | - | |
| Wonderland/ | 2024-07-26 15:35 | - | |
| Wrongful Death/ | 2024-09-06 23:38 | - | |
| YOLO/ | 2024-08-04 16:19 | - | |
| Youjo Senki Sabaku no Pasta Dai Sakusen/ | 2024-09-08 01:15 | - | |
| Young Woman and the Sea/ | 2024-07-20 22:00 | - | |
| Youre Next/ | 2024-07-18 16:58 | - | |
| Youre So Cupid/ | 2024-04-10 16:41 | - | |
| Zack and Miri Make a Porno/ | 2024-07-01 04:18 | - | |
| Zazie dans le metro/ | 2024-05-20 01:24 | - | |
| Zhong quan ba gong/ | 2024-05-01 17:05 | - | |
| Zona de interés/ | 2024-04-02 01:34 | - | |
| amarte/ | 2024-02-24 04:33 | - | |
| batman caballero de la noche/ | 2024-07-17 17:01 | - | |
| batman el regreso del caballero oscuro parte 2/ | 2024-07-17 17:01 | - | |
| batman v superman el amanecer de la justicia/ | 2024-07-17 17:02 | - | |
| brincos dieras TETEPA TITLÁN/ | 2024-07-04 02:41 | - | |
| el favor/ | 2024-03-12 22:01 | - | |
| exterminador/ | 2024-05-02 04:30 | - | |
| jacobs Ladder 1/ | 2024-07-13 17:10 | - | |
| sea of shadows/ | 2024-05-11 20:09 | - | |
| toy story/ | 2024-07-16 02:22 | - | |